C18H42N2O8Si2 — CID 87214353
N'-(3-trimethoxysilylpropyl)ethane-1,2-diamine;1-trimethoxysilylpropyl 2-methylprop-2-enoate (PubChem CID 87214353) has the molecular formula C18H42N2O8Si2 and a molecular weight of 470.71 g/mol. Its IUPAC name is N'-(3-trimethoxysilylpropyl)ethane-1,2-diamine;1-trimethoxysilylpropyl 2-methylprop-2-enoate.
| Compound Name | N'-(3-trimethoxysilylpropyl)ethane-1,2-diamine;1-trimethoxysilylpropyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 87214353 |
| Molecular Formula | C18H42N2O8Si2 |
| Molecular Weight | 470.71 g/mol |
| Exact Mass | 470.25 |
| IUPAC Name | N'-(3-trimethoxysilylpropyl)ethane-1,2-diamine;1-trimethoxysilylpropyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(CC)[Si](OC)(OC)OC.CO[Si](CCCNCCN)(OC)OC |
| InChI | InChI=1S/C10H20O5Si.C8H22N2O3Si/c1-7-9(15-10(11)8(2)3)16(12-4,13-5)14-6;1-11-14(12-2,13-3)8-4-6-10-7-5-9/h9H,2,7H2,1,3-6H3;10H,4-9H2,1-3H3 |
| InChIKey | ANCVJQSLSQEXTR-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 119.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.71 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|