C10H24O4Si3 — CID 173234649
1-[methyl-bis(methylsilyloxy)silyl]propyl 2-methylprop-2-enoate (PubChem CID 173234649) has the molecular formula C10H24O4Si3 and a molecular weight of 292.56 g/mol. Its IUPAC name is 1-[methyl-bis(methylsilyloxy)silyl]propyl 2-methylprop-2-enoate.
| Compound Name | 1-[methyl-bis(methylsilyloxy)silyl]propyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 173234649 |
| Molecular Formula | C10H24O4Si3 |
| Molecular Weight | 292.56 g/mol |
| Exact Mass | 292.10 |
| IUPAC Name | 1-[methyl-bis(methylsilyloxy)silyl]propyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(CC)[Si](C)(O[SiH2]C)O[SiH2]C |
| InChI | InChI=1S/C10H24O4Si3/c1-7-9(12-10(11)8(2)3)17(6,13-15-4)14-16-5/h9H,2,7,15-16H2,1,3-6H3 |
| InChIKey | SRQCBGMBVWKUDS-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.56 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|