C22H48O8Si3 — CID 175321333
1-[diethoxy(methyl)silyl]propyl 2-methylprop-2-enoate;1-dimethoxysilylbutan-2-yl 2-methylprop-2-enoate;silane (PubChem CID 175321333) has the molecular formula C22H48O8Si3 and a molecular weight of 524.88 g/mol. Its IUPAC name is 1-[diethoxy(methyl)silyl]propyl 2-methylprop-2-enoate;1-dimethoxysilylbutan-2-yl 2-methylprop-2-enoate;silane.
| Compound Name | 1-[diethoxy(methyl)silyl]propyl 2-methylprop-2-enoate;1-dimethoxysilylbutan-2-yl 2-methylprop-2-enoate;silane |
|---|---|
| PubChem CID | 175321333 |
| Molecular Formula | C22H48O8Si3 |
| Molecular Weight | 524.88 g/mol |
| Exact Mass | 524.27 |
| IUPAC Name | 1-[diethoxy(methyl)silyl]propyl 2-methylprop-2-enoate;1-dimethoxysilylbutan-2-yl 2-methylprop-2-enoate;silane |
| SMILES | C=C(C)C(=O)OC(CC)C[SiH](OC)OC.C=C(C)C(=O)OC(CC)[Si](C)(OCC)OCC.[SiH4] |
| InChI | InChI=1S/C12H24O4Si.C10H20O4Si.H4Si/c1-7-11(16-12(13)10(4)5)17(6,14-8-2)15-9-3;1-6-9(7-15(12-4)13-5)14-10(11)8(2)3;/h11H,4,7-9H2,1-3,5-6H3;9,15H,2,6-7H2,1,3-5H3;1H4 |
| InChIKey | DIPFTVVLZTUUQF-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.88 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|