C16H28O6 — CID 122641854
butane-1,4-diol;2-(2-methylprop-2-enoyloxy)butyl 2-methylprop-2-enoate (PubChem CID 122641854) has the molecular formula C16H28O6 and a molecular weight of 316.39 g/mol. Its IUPAC name is butane-1,4-diol;2-(2-methylprop-2-enoyloxy)butyl 2-methylprop-2-enoate.
| Compound Name | butane-1,4-diol;2-(2-methylprop-2-enoyloxy)butyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 122641854 |
| Molecular Formula | C16H28O6 |
| Molecular Weight | 316.39 g/mol |
| Exact Mass | 316.19 |
| IUPAC Name | butane-1,4-diol;2-(2-methylprop-2-enoyloxy)butyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(CC)OC(=O)C(=C)C.OCCCCO |
| InChI | InChI=1S/C12H18O4.C4H10O2/c1-6-10(16-12(14)9(4)5)7-15-11(13)8(2)3;5-3-1-2-4-6/h10H,2,4,6-7H2,1,3,5H3;5-6H,1-4H2 |
| InChIKey | KGCUZWPEJIWRSI-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.39 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|