C12H22O3 — CID 87140924
(2-ethyl-6-hydroxyhexyl) 2-methylprop-2-enoate (PubChem CID 87140924) has the molecular formula C12H22O3 and a molecular weight of 214.30 g/mol. Its IUPAC name is (2-ethyl-6-hydroxyhexyl) 2-methylprop-2-enoate.
| Compound Name | (2-ethyl-6-hydroxyhexyl) 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 87140924 |
| Molecular Formula | C12H22O3 |
| Molecular Weight | 214.30 g/mol |
| Exact Mass | 214.16 |
| IUPAC Name | (2-ethyl-6-hydroxyhexyl) 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(CC)CCCCO |
| InChI | InChI=1S/C12H22O3/c1-4-11(7-5-6-8-13)9-15-12(14)10(2)3/h11,13H,2,4-9H2,1,3H3 |
| InChIKey | CTNSOJDRWGNOTO-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.30 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|