C28H54O2 — CID 140900809
[12-methyl-2-(8-methylnonyl)tridecyl] 2-methylprop-2-enoate (PubChem CID 140900809) has the molecular formula C28H54O2 and a molecular weight of 422.74 g/mol. Its IUPAC name is [12-methyl-2-(8-methylnonyl)tridecyl] 2-methylprop-2-enoate.
| Compound Name | [12-methyl-2-(8-methylnonyl)tridecyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 140900809 |
| Molecular Formula | C28H54O2 |
| Molecular Weight | 422.74 g/mol |
| Exact Mass | 422.41 |
| IUPAC Name | [12-methyl-2-(8-methylnonyl)tridecyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(CCCCCCCCCC(C)C)CCCCCCCC(C)C |
| InChI | InChI=1S/C28H54O2/c1-24(2)19-15-11-8-7-9-13-17-21-27(23-30-28(29)26(5)6)22-18-14-10-12-16-20-25(3)4/h24-25,27H,5,7-23H2,1-4,6H3 |
| InChIKey | IHHGNNREBBTSFY-UHFFFAOYSA-N |
| XLogP | 9.28 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.74 |
| LogP ≤ 5 | 9.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|