C10H22O6Si2 — CID 151704655
1-trimethoxysilyloxysilylpropyl 2-methylprop-2-enoate (PubChem CID 151704655) has the molecular formula C10H22O6Si2 and a molecular weight of 294.45 g/mol. Its IUPAC name is 1-trimethoxysilyloxysilylpropyl 2-methylprop-2-enoate.
| Compound Name | 1-trimethoxysilyloxysilylpropyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 151704655 |
| Molecular Formula | C10H22O6Si2 |
| Molecular Weight | 294.45 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | 1-trimethoxysilyloxysilylpropyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(CC)[SiH2]O[Si](OC)(OC)OC |
| InChI | InChI=1S/C10H22O6Si2/c1-7-9(15-10(11)8(2)3)17-16-18(12-4,13-5)14-6/h9H,2,7,17H2,1,3-6H3 |
| InChIKey | RFIFMTMZUVZDID-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.45 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|