C16H26FNO5 — CID 88627318
1-fluoropropyl 2-methylprop-2-enoate;methyl 2-methylprop-2-enoate;2-methylprop-2-enamide (PubChem CID 88627318) has the molecular formula C16H26FNO5 and a molecular weight of 331.38 g/mol. Its IUPAC name is 1-fluoropropyl 2-methylprop-2-enoate;methyl 2-methylprop-2-enoate;2-methylprop-2-enamide.
| Compound Name | 1-fluoropropyl 2-methylprop-2-enoate;methyl 2-methylprop-2-enoate;2-methylprop-2-enamide |
|---|---|
| PubChem CID | 88627318 |
| Molecular Formula | C16H26FNO5 |
| Molecular Weight | 331.38 g/mol |
| Exact Mass | 331.18 |
| IUPAC Name | 1-fluoropropyl 2-methylprop-2-enoate;methyl 2-methylprop-2-enoate;2-methylprop-2-enamide |
| SMILES | C=C(C)C(=O)OC.C=C(C)C(=O)OC(F)CC.C=C(C)C(N)=O |
| InChI | InChI=1S/C7H11FO2.C5H8O2.C4H7NO/c1-4-6(8)10-7(9)5(2)3;1-4(2)5(6)7-3;1-3(2)4(5)6/h6H,2,4H2,1,3H3;1H2,2-3H3;1H2,2H3,(H2,5,6) |
| InChIKey | WTRUFZQEITUKFM-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 95.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.38 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|