C12H19NO3 — CID 172526451
[(E)-7-amino-6-methyl-7-oxohept-5-en-3-yl] 2-methylprop-2-enoate (PubChem CID 172526451) has the molecular formula C12H19NO3 and a molecular weight of 225.29 g/mol. Its IUPAC name is [(E)-7-amino-6-methyl-7-oxohept-5-en-3-yl] 2-methylprop-2-enoate.
| Compound Name | [(E)-7-amino-6-methyl-7-oxohept-5-en-3-yl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 172526451 |
| Molecular Formula | C12H19NO3 |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.14 |
| IUPAC Name | [(E)-7-amino-6-methyl-7-oxohept-5-en-3-yl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(CC)C/C=C(\C)C(N)=O |
| InChI | InChI=1S/C12H19NO3/c1-5-10(16-12(15)8(2)3)7-6-9(4)11(13)14/h6,10H,2,5,7H2,1,3-4H3,(H2,13,14)/b9-6+ |
| InChIKey | HSKQAILHDNRLQY-RMKNXTFCSA-N |
| XLogP | 1.71 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|