C9H17NO — CID 140547183
2,5-dimethylhept-2-enamide (PubChem CID 140547183) has the molecular formula C9H17NO and a molecular weight of 155.24 g/mol. Its IUPAC name is 2,5-dimethylhept-2-enamide.
| Compound Name | 2,5-dimethylhept-2-enamide |
|---|---|
| PubChem CID | 140547183 |
| Molecular Formula | C9H17NO |
| Molecular Weight | 155.24 g/mol |
| Exact Mass | 155.13 |
| IUPAC Name | 2,5-dimethylhept-2-enamide |
| SMILES | CCC(C)CC=C(C)C(N)=O |
| InChI | InChI=1S/C9H17NO/c1-4-7(2)5-6-8(3)9(10)11/h6-7H,4-5H2,1-3H3,(H2,10,11) |
| InChIKey | QSDMHCZFQPAHSU-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.24 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|