C9H15NO — CID 90684610
2,4-dimethylhepta-2,4-dienamide (PubChem CID 90684610) has the molecular formula C9H15NO and a molecular weight of 153.22 g/mol. Its IUPAC name is 2,4-dimethylhepta-2,4-dienamide.
| Compound Name | 2,4-dimethylhepta-2,4-dienamide |
|---|---|
| PubChem CID | 90684610 |
| Molecular Formula | C9H15NO |
| Molecular Weight | 153.22 g/mol |
| Exact Mass | 153.12 |
| IUPAC Name | 2,4-dimethylhepta-2,4-dienamide |
| SMILES | CCC=C(C)C=C(C)C(N)=O |
| InChI | InChI=1S/C9H15NO/c1-4-5-7(2)6-8(3)9(10)11/h5-6H,4H2,1-3H3,(H2,10,11) |
| InChIKey | CGTMHMZHACBDBS-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.22 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|