About N,N-dimethylethanamine;2-methylpent-2-enamide
N,N-dimethylethanamine;2-methylpent-2-enamide (PubChem CID 172721563) has the molecular formula C10H22N2O
and a molecular weight of 186.30 g/mol. Its IUPAC name is N,N-dimethylethanamine;2-methylpent-2-enamide.
Molecular Properties
| Compound Name | N,N-dimethylethanamine;2-methylpent-2-enamide |
| PubChem CID | 172721563 |
| Molecular Formula | C10H22N2O |
| Molecular Weight | 186.30 g/mol |
| Exact Mass | 186.17 |
| IUPAC Name | N,N-dimethylethanamine;2-methylpent-2-enamide |
| SMILES | CCC=C(C)C(N)=O.CCN(C)C |
| InChI | InChI=1S/C6H11NO.C4H11N/c1-3-4-5(2)6(7)8;1-4-5(2)3/h4H,3H2,1-2H3,(H2,7,8);4H2,1-3H3 |
| InChIKey | GOUPEVSLVOXCHP-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.30 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze N,N-dimethylethanamine;2-methylpent-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethylethanamine;2-methylpent-2-enamide?
The IUPAC name of N,N-dimethylethanamine;2-methylpent-2-enamide (CID 172721563) is N,N-dimethylethanamine;2-methylpent-2-enamide.
What is the SMILES notation for N,N-dimethylethanamine;2-methylpent-2-enamide?
The canonical SMILES for N,N-dimethylethanamine;2-methylpent-2-enamide is CCC=C(C)C(N)=O.CCN(C)C.
What is the InChIKey of N,N-dimethylethanamine;2-methylpent-2-enamide?
The InChIKey is GOUPEVSLVOXCHP-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11NO.C4H11N/c1-3-4-5(2)6(7)8;1-4-5(2)3/h4H,3H2,1-2H3,(H2,7,8);4H2,1-3H3.
What are the key properties of N,N-dimethylethanamine;2-methylpent-2-enamide?
N,N-dimethylethanamine;2-methylpent-2-enamide has a molecular weight of 186.30 g/mol, XLogP of 1.40, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethylethanamine;2-methylpent-2-enamide is sourced from PubChem (CID 172721563), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).