C21H45BrN2O — CID 173350298
N,N-dimethyldodecan-1-amine;2-methylhex-2-enamide;hydrobromide (PubChem CID 173350298) has the molecular formula C21H45BrN2O and a molecular weight of 421.51 g/mol. Its IUPAC name is N,N-dimethyldodecan-1-amine;2-methylhex-2-enamide;hydrobromide.
| Compound Name | N,N-dimethyldodecan-1-amine;2-methylhex-2-enamide;hydrobromide |
|---|---|
| PubChem CID | 173350298 |
| Molecular Formula | C21H45BrN2O |
| Molecular Weight | 421.51 g/mol |
| Exact Mass | 420.27 |
| IUPAC Name | N,N-dimethyldodecan-1-amine;2-methylhex-2-enamide;hydrobromide |
| SMILES | Br.CCCC=C(C)C(N)=O.CCCCCCCCCCCCN(C)C |
| InChI | InChI=1S/C14H31N.C7H13NO.BrH/c1-4-5-6-7-8-9-10-11-12-13-14-15(2)3;1-3-4-5-6(2)7(8)9;/h4-14H2,1-3H3;5H,3-4H2,1-2H3,(H2,8,9);1H |
| InChIKey | DGIKWMYHVBARLE-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.51 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|