About 2-methylhex-2-enamide;propan-1-amine
2-methylhex-2-enamide;propan-1-amine (PubChem CID 174435970) has the molecular formula C10H22N2O
and a molecular weight of 186.30 g/mol. Its IUPAC name is 2-methylhex-2-enamide;propan-1-amine.
Molecular Properties
| Compound Name | 2-methylhex-2-enamide;propan-1-amine |
| PubChem CID | 174435970 |
| Molecular Formula | C10H22N2O |
| Molecular Weight | 186.30 g/mol |
| Exact Mass | 186.17 |
| IUPAC Name | 2-methylhex-2-enamide;propan-1-amine |
| SMILES | CCCC=C(C)C(N)=O.CCCN |
| InChI | InChI=1S/C7H13NO.C3H9N/c1-3-4-5-6(2)7(8)9;1-2-3-4/h5H,3-4H2,1-2H3,(H2,8,9);2-4H2,1H3 |
| InChIKey | NSHOQYSPHNAZKE-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.30 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-methylhex-2-enamide;propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylhex-2-enamide;propan-1-amine?
The IUPAC name of 2-methylhex-2-enamide;propan-1-amine (CID 174435970) is 2-methylhex-2-enamide;propan-1-amine.
What is the SMILES notation for 2-methylhex-2-enamide;propan-1-amine?
The canonical SMILES for 2-methylhex-2-enamide;propan-1-amine is CCCC=C(C)C(N)=O.CCCN.
What is the InChIKey of 2-methylhex-2-enamide;propan-1-amine?
The InChIKey is NSHOQYSPHNAZKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13NO.C3H9N/c1-3-4-5-6(2)7(8)9;1-2-3-4/h5H,3-4H2,1-2H3,(H2,8,9);2-4H2,1H3.
What are the key properties of 2-methylhex-2-enamide;propan-1-amine?
2-methylhex-2-enamide;propan-1-amine has a molecular weight of 186.30 g/mol, XLogP of 1.57, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylhex-2-enamide;propan-1-amine is sourced from PubChem (CID 174435970), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).