About 2-methylhept-2-enamide;hydrate
2-methylhept-2-enamide;hydrate (PubChem CID 172812574) has the molecular formula C8H17NO2
and a molecular weight of 159.23 g/mol. Its IUPAC name is 2-methylhept-2-enamide;hydrate.
Molecular Properties
| Compound Name | 2-methylhept-2-enamide;hydrate |
| PubChem CID | 172812574 |
| Molecular Formula | C8H17NO2 |
| Molecular Weight | 159.23 g/mol |
| Exact Mass | 159.13 |
| IUPAC Name | 2-methylhept-2-enamide;hydrate |
| SMILES | CCCCC=C(C)C(N)=O.O |
| InChI | InChI=1S/C8H15NO.H2O/c1-3-4-5-6-7(2)8(9)10;/h6H,3-5H2,1-2H3,(H2,9,10);1H2 |
| InChIKey | MJHFARVJLCSXAU-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 74.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.23 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-methylhept-2-enamide;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylhept-2-enamide;hydrate?
The IUPAC name of 2-methylhept-2-enamide;hydrate (CID 172812574) is 2-methylhept-2-enamide;hydrate.
What is the SMILES notation for 2-methylhept-2-enamide;hydrate?
The canonical SMILES for 2-methylhept-2-enamide;hydrate is CCCCC=C(C)C(N)=O.O.
What is the InChIKey of 2-methylhept-2-enamide;hydrate?
The InChIKey is MJHFARVJLCSXAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15NO.H2O/c1-3-4-5-6-7(2)8(9)10;/h6H,3-5H2,1-2H3,(H2,9,10);1H2.
What are the key properties of 2-methylhept-2-enamide;hydrate?
2-methylhept-2-enamide;hydrate has a molecular weight of 159.23 g/mol, XLogP of 0.78, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylhept-2-enamide;hydrate is sourced from PubChem (CID 172812574), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).