About 2-methylhept-2-enamide;oxolane
2-methylhept-2-enamide;oxolane (PubChem CID 174959679) has the molecular formula C12H23NO2
and a molecular weight of 213.32 g/mol. Its IUPAC name is 2-methylhept-2-enamide;oxolane.
Molecular Properties
| Compound Name | 2-methylhept-2-enamide;oxolane |
| PubChem CID | 174959679 |
| Molecular Formula | C12H23NO2 |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.17 |
| IUPAC Name | 2-methylhept-2-enamide;oxolane |
| SMILES | C1CCOC1.CCCCC=C(C)C(N)=O |
| InChI | InChI=1S/C8H15NO.C4H8O/c1-3-4-5-6-7(2)8(9)10;1-2-4-5-3-1/h6H,3-5H2,1-2H3,(H2,9,10);1-4H2 |
| InChIKey | YPRYHBNWLTZATG-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-methylhept-2-enamide;oxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylhept-2-enamide;oxolane?
The IUPAC name of 2-methylhept-2-enamide;oxolane (CID 174959679) is 2-methylhept-2-enamide;oxolane.
What is the SMILES notation for 2-methylhept-2-enamide;oxolane?
The canonical SMILES for 2-methylhept-2-enamide;oxolane is C1CCOC1.CCCCC=C(C)C(N)=O.
What is the InChIKey of 2-methylhept-2-enamide;oxolane?
The InChIKey is YPRYHBNWLTZATG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15NO.C4H8O/c1-3-4-5-6-7(2)8(9)10;1-2-4-5-3-1/h6H,3-5H2,1-2H3,(H2,9,10);1-4H2.
What are the key properties of 2-methylhept-2-enamide;oxolane?
2-methylhept-2-enamide;oxolane has a molecular weight of 213.32 g/mol, XLogP of 2.40, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylhept-2-enamide;oxolane is sourced from PubChem (CID 174959679), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).