About oxetan-3-ylmethyl (E)-2-methylhept-2-enoate
oxetan-3-ylmethyl (E)-2-methylhept-2-enoate (PubChem CID 22186337) has the molecular formula C12H20O3
and a molecular weight of 212.29 g/mol. Its IUPAC name is oxetan-3-ylmethyl (E)-2-methylhept-2-enoate.
Molecular Properties
| Compound Name | oxetan-3-ylmethyl (E)-2-methylhept-2-enoate |
| PubChem CID | 22186337 |
| Molecular Formula | C12H20O3 |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.14 |
| IUPAC Name | oxetan-3-ylmethyl (E)-2-methylhept-2-enoate |
| SMILES | CCCC/C=C(\C)C(=O)OCC1COC1 |
| InChI | InChI=1S/C12H20O3/c1-3-4-5-6-10(2)12(13)15-9-11-7-14-8-11/h6,11H,3-5,7-9H2,1-2H3/b10-6+ |
| InChIKey | GUCILJKJACZBIH-UXBLZVDNSA-N |
| XLogP | 2.31 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze oxetan-3-ylmethyl (E)-2-methylhept-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxetan-3-ylmethyl (E)-2-methylhept-2-enoate?
The IUPAC name of oxetan-3-ylmethyl (E)-2-methylhept-2-enoate (CID 22186337) is oxetan-3-ylmethyl (E)-2-methylhept-2-enoate.
What is the SMILES notation for oxetan-3-ylmethyl (E)-2-methylhept-2-enoate?
The canonical SMILES for oxetan-3-ylmethyl (E)-2-methylhept-2-enoate is CCCC/C=C(\C)C(=O)OCC1COC1.
What is the InChIKey of oxetan-3-ylmethyl (E)-2-methylhept-2-enoate?
The InChIKey is GUCILJKJACZBIH-UXBLZVDNSA-N. The full InChI is InChI=1S/C12H20O3/c1-3-4-5-6-10(2)12(13)15-9-11-7-14-8-11/h6,11H,3-5,7-9H2,1-2H3/b10-6+.
What are the key properties of oxetan-3-ylmethyl (E)-2-methylhept-2-enoate?
oxetan-3-ylmethyl (E)-2-methylhept-2-enoate has a molecular weight of 212.29 g/mol, XLogP of 2.31, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for oxetan-3-ylmethyl (E)-2-methylhept-2-enoate is sourced from PubChem (CID 22186337), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).