About ethoxyethane;oxiran-2-ylmethyl (E)-9-hydroxy-2-methylnon-2-enoate
ethoxyethane;oxiran-2-ylmethyl (E)-9-hydroxy-2-methylnon-2-enoate (PubChem CID 87621476) has the molecular formula C17H32O5
and a molecular weight of 316.44 g/mol. Its IUPAC name is ethoxyethane;oxiran-2-ylmethyl (E)-9-hydroxy-2-methylnon-2-enoate.
Molecular Properties
| Compound Name | ethoxyethane;oxiran-2-ylmethyl (E)-9-hydroxy-2-methylnon-2-enoate |
| PubChem CID | 87621476 |
| Molecular Formula | C17H32O5 |
| Molecular Weight | 316.44 g/mol |
| Exact Mass | 316.22 |
| IUPAC Name | ethoxyethane;oxiran-2-ylmethyl (E)-9-hydroxy-2-methylnon-2-enoate |
| SMILES | C/C(=C\CCCCCCO)C(=O)OCC1CO1.CCOCC |
| InChI | InChI=1S/C13H22O4.C4H10O/c1-11(7-5-3-2-4-6-8-14)13(15)17-10-12-9-16-12;1-3-5-4-2/h7,12,14H,2-6,8-10H2,1H3;3-4H2,1-2H3/b11-7+; |
| InChIKey | DJMFKLTVQVQXAQ-RVDQCCQOSA-N |
| XLogP | 2.86 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.44 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze ethoxyethane;oxiran-2-ylmethyl (E)-9-hydroxy-2-methylnon-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethoxyethane;oxiran-2-ylmethyl (E)-9-hydroxy-2-methylnon-2-enoate?
The IUPAC name of ethoxyethane;oxiran-2-ylmethyl (E)-9-hydroxy-2-methylnon-2-enoate (CID 87621476) is ethoxyethane;oxiran-2-ylmethyl (E)-9-hydroxy-2-methylnon-2-enoate.
What is the SMILES notation for ethoxyethane;oxiran-2-ylmethyl (E)-9-hydroxy-2-methylnon-2-enoate?
The canonical SMILES for ethoxyethane;oxiran-2-ylmethyl (E)-9-hydroxy-2-methylnon-2-enoate is C/C(=C\CCCCCCO)C(=O)OCC1CO1.CCOCC.
What is the InChIKey of ethoxyethane;oxiran-2-ylmethyl (E)-9-hydroxy-2-methylnon-2-enoate?
The InChIKey is DJMFKLTVQVQXAQ-RVDQCCQOSA-N. The full InChI is InChI=1S/C13H22O4.C4H10O/c1-11(7-5-3-2-4-6-8-14)13(15)17-10-12-9-16-12;1-3-5-4-2/h7,12,14H,2-6,8-10H2,1H3;3-4H2,1-2H3/b11-7+;.
What are the key properties of ethoxyethane;oxiran-2-ylmethyl (E)-9-hydroxy-2-methylnon-2-enoate?
ethoxyethane;oxiran-2-ylmethyl (E)-9-hydroxy-2-methylnon-2-enoate has a molecular weight of 316.44 g/mol, XLogP of 2.86, 11 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethoxyethane;oxiran-2-ylmethyl (E)-9-hydroxy-2-methylnon-2-enoate is sourced from PubChem (CID 87621476), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).