About carbamoyl 2-methylhex-2-eneperoxoate
carbamoyl 2-methylhex-2-eneperoxoate (PubChem CID 173307552) has the molecular formula C8H13NO4
and a molecular weight of 187.19 g/mol. Its IUPAC name is carbamoyl 2-methylhex-2-eneperoxoate.
Molecular Properties
| Compound Name | carbamoyl 2-methylhex-2-eneperoxoate |
| PubChem CID | 173307552 |
| Molecular Formula | C8H13NO4 |
| Molecular Weight | 187.19 g/mol |
| Exact Mass | 187.08 |
| IUPAC Name | carbamoyl 2-methylhex-2-eneperoxoate |
| SMILES | CCCC=C(C)C(=O)OOC(N)=O |
| InChI | InChI=1S/C8H13NO4/c1-3-4-5-6(2)7(10)12-13-8(9)11/h5H,3-4H2,1-2H3,(H2,9,11) |
| InChIKey | ADAYURTZHWEUTF-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.19 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze carbamoyl 2-methylhex-2-eneperoxoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbamoyl 2-methylhex-2-eneperoxoate?
The IUPAC name of carbamoyl 2-methylhex-2-eneperoxoate (CID 173307552) is carbamoyl 2-methylhex-2-eneperoxoate.
What is the SMILES notation for carbamoyl 2-methylhex-2-eneperoxoate?
The canonical SMILES for carbamoyl 2-methylhex-2-eneperoxoate is CCCC=C(C)C(=O)OOC(N)=O.
What is the InChIKey of carbamoyl 2-methylhex-2-eneperoxoate?
The InChIKey is ADAYURTZHWEUTF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13NO4/c1-3-4-5-6(2)7(10)12-13-8(9)11/h5H,3-4H2,1-2H3,(H2,9,11).
What are the key properties of carbamoyl 2-methylhex-2-eneperoxoate?
carbamoyl 2-methylhex-2-eneperoxoate has a molecular weight of 187.19 g/mol, XLogP of 1.29, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for carbamoyl 2-methylhex-2-eneperoxoate is sourced from PubChem (CID 173307552), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).