About sulfo (E)-2-methylhex-2-enoate
sulfo (E)-2-methylhex-2-enoate (PubChem CID 87119390) has the molecular formula C7H12O5S
and a molecular weight of 208.23 g/mol. Its IUPAC name is sulfo (E)-2-methylhex-2-enoate.
Molecular Properties
| Compound Name | sulfo (E)-2-methylhex-2-enoate |
| PubChem CID | 87119390 |
| Molecular Formula | C7H12O5S |
| Molecular Weight | 208.23 g/mol |
| Exact Mass | 208.04 |
| IUPAC Name | sulfo (E)-2-methylhex-2-enoate |
| SMILES | CCC/C=C(\C)C(=O)OS(=O)(=O)O |
| InChI | InChI=1S/C7H12O5S/c1-3-4-5-6(2)7(8)12-13(9,10)11/h5H,3-4H2,1-2H3,(H,9,10,11)/b6-5+ |
| InChIKey | CAHHJUUNPLUTBP-AATRIKPKSA-N |
| XLogP | 1.08 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.23 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze sulfo (E)-2-methylhex-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sulfo (E)-2-methylhex-2-enoate?
The IUPAC name of sulfo (E)-2-methylhex-2-enoate (CID 87119390) is sulfo (E)-2-methylhex-2-enoate.
What is the SMILES notation for sulfo (E)-2-methylhex-2-enoate?
The canonical SMILES for sulfo (E)-2-methylhex-2-enoate is CCC/C=C(\C)C(=O)OS(=O)(=O)O.
What is the InChIKey of sulfo (E)-2-methylhex-2-enoate?
The InChIKey is CAHHJUUNPLUTBP-AATRIKPKSA-N. The full InChI is InChI=1S/C7H12O5S/c1-3-4-5-6(2)7(8)12-13(9,10)11/h5H,3-4H2,1-2H3,(H,9,10,11)/b6-5+.
What are the key properties of sulfo (E)-2-methylhex-2-enoate?
sulfo (E)-2-methylhex-2-enoate has a molecular weight of 208.23 g/mol, XLogP of 1.08, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for sulfo (E)-2-methylhex-2-enoate is sourced from PubChem (CID 87119390), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).