C20H38N2O2 — CID 158002582
N-hexyl-N-methylprop-2-enamide;2-methylnon-2-enamide (PubChem CID 158002582) has the molecular formula C20H38N2O2 and a molecular weight of 338.54 g/mol. Its IUPAC name is N-hexyl-N-methylprop-2-enamide;2-methylnon-2-enamide.
| Compound Name | N-hexyl-N-methylprop-2-enamide;2-methylnon-2-enamide |
|---|---|
| PubChem CID | 158002582 |
| Molecular Formula | C20H38N2O2 |
| Molecular Weight | 338.54 g/mol |
| Exact Mass | 338.29 |
| IUPAC Name | N-hexyl-N-methylprop-2-enamide;2-methylnon-2-enamide |
| SMILES | C=CC(=O)N(C)CCCCCC.CCCCCCC=C(C)C(N)=O |
| InChI | InChI=1S/2C10H19NO/c1-4-6-7-8-9-11(3)10(12)5-2;1-3-4-5-6-7-8-9(2)10(11)12/h5H,2,4,6-9H2,1,3H3;8H,3-7H2,1-2H3,(H2,11,12) |
| InChIKey | FDXHBTWEVBLIPY-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.54 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|