C14H31N3O2 — CID 174907483
N,N-dimethylhexan-1-amine;hexanediamide (PubChem CID 174907483) has the molecular formula C14H31N3O2 and a molecular weight of 273.42 g/mol. Its IUPAC name is N,N-dimethylhexan-1-amine;hexanediamide.
| Compound Name | N,N-dimethylhexan-1-amine;hexanediamide |
|---|---|
| PubChem CID | 174907483 |
| Molecular Formula | C14H31N3O2 |
| Molecular Weight | 273.42 g/mol |
| Exact Mass | 273.24 |
| IUPAC Name | N,N-dimethylhexan-1-amine;hexanediamide |
| SMILES | CCCCCCN(C)C.NC(=O)CCCCC(N)=O |
| InChI | InChI=1S/C8H19N.C6H12N2O2/c1-4-5-6-7-8-9(2)3;7-5(9)3-1-2-4-6(8)10/h4-8H2,1-3H3;1-4H2,(H2,7,9)(H2,8,10) |
| InChIKey | NQGGYIJHRXAQMU-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 89.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.42 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|