About N-butyl-N-methylhydroxylamine;octanamide
N-butyl-N-methylhydroxylamine;octanamide (PubChem CID 175725014) has the molecular formula C13H30N2O2
and a molecular weight of 246.39 g/mol. Its IUPAC name is N-butyl-N-methylhydroxylamine;octanamide.
Molecular Properties
| Compound Name | N-butyl-N-methylhydroxylamine;octanamide |
| PubChem CID | 175725014 |
| Molecular Formula | C13H30N2O2 |
| Molecular Weight | 246.39 g/mol |
| Exact Mass | 246.23 |
| IUPAC Name | N-butyl-N-methylhydroxylamine;octanamide |
| SMILES | CCCCCCCC(N)=O.CCCCN(C)O |
| InChI | InChI=1S/C8H17NO.C5H13NO/c1-2-3-4-5-6-7-8(9)10;1-3-4-5-6(2)7/h2-7H2,1H3,(H2,9,10);7H,3-5H2,1-2H3 |
| InChIKey | ZYHQOYPKJQOXDK-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.39 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-butyl-N-methylhydroxylamine;octanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butyl-N-methylhydroxylamine;octanamide?
The IUPAC name of N-butyl-N-methylhydroxylamine;octanamide (CID 175725014) is N-butyl-N-methylhydroxylamine;octanamide.
What is the SMILES notation for N-butyl-N-methylhydroxylamine;octanamide?
The canonical SMILES for N-butyl-N-methylhydroxylamine;octanamide is CCCCCCCC(N)=O.CCCCN(C)O.
What is the InChIKey of N-butyl-N-methylhydroxylamine;octanamide?
The InChIKey is ZYHQOYPKJQOXDK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17NO.C5H13NO/c1-2-3-4-5-6-7-8(9)10;1-3-4-5-6(2)7/h2-7H2,1H3,(H2,9,10);7H,3-5H2,1-2H3.
What are the key properties of N-butyl-N-methylhydroxylamine;octanamide?
N-butyl-N-methylhydroxylamine;octanamide has a molecular weight of 246.39 g/mol, XLogP of 2.94, 9 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-butyl-N-methylhydroxylamine;octanamide is sourced from PubChem (CID 175725014), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).