C15H34N2O — CID 160827812
decanamide;N,N-dimethylpropan-1-amine (PubChem CID 160827812) has the molecular formula C15H34N2O and a molecular weight of 258.45 g/mol. Its IUPAC name is decanamide;N,N-dimethylpropan-1-amine.
| Compound Name | decanamide;N,N-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 160827812 |
| Molecular Formula | C15H34N2O |
| Molecular Weight | 258.45 g/mol |
| Exact Mass | 258.27 |
| IUPAC Name | decanamide;N,N-dimethylpropan-1-amine |
| SMILES | CCCCCCCCCC(N)=O.CCCN(C)C |
| InChI | InChI=1S/C10H21NO.C5H13N/c1-2-3-4-5-6-7-8-9-10(11)12;1-4-5-6(2)3/h2-9H2,1H3,(H2,11,12);4-5H2,1-3H3 |
| InChIKey | SGKJPTUGIJBWFT-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.45 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|