About 3-(dimethylamino)propanamide;docosanoic acid
3-(dimethylamino)propanamide;docosanoic acid (PubChem CID 87446955) has the molecular formula C27H56N2O3
and a molecular weight of 456.76 g/mol. Its IUPAC name is 3-(dimethylamino)propanamide;docosanoic acid.
Molecular Properties
| Compound Name | 3-(dimethylamino)propanamide;docosanoic acid |
| PubChem CID | 87446955 |
| Molecular Formula | C27H56N2O3 |
| Molecular Weight | 456.76 g/mol |
| Exact Mass | 456.43 |
| IUPAC Name | 3-(dimethylamino)propanamide;docosanoic acid |
| SMILES | CCCCCCCCCCCCCCCCCCCCCC(=O)O.CN(C)CCC(N)=O |
| InChI | InChI=1S/C22H44O2.C5H12N2O/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22(23)24;1-7(2)4-3-5(6)8/h2-21H2,1H3,(H,23,24);3-4H2,1-2H3,(H2,6,8) |
| InChIKey | ZIEWYBAKQBYTLU-UHFFFAOYSA-N |
| XLogP | 7.32 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 456.76 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-(dimethylamino)propanamide;docosanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(dimethylamino)propanamide;docosanoic acid?
The IUPAC name of 3-(dimethylamino)propanamide;docosanoic acid (CID 87446955) is 3-(dimethylamino)propanamide;docosanoic acid.
What is the SMILES notation for 3-(dimethylamino)propanamide;docosanoic acid?
The canonical SMILES for 3-(dimethylamino)propanamide;docosanoic acid is CCCCCCCCCCCCCCCCCCCCCC(=O)O.CN(C)CCC(N)=O.
What is the InChIKey of 3-(dimethylamino)propanamide;docosanoic acid?
The InChIKey is ZIEWYBAKQBYTLU-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H44O2.C5H12N2O/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22(23)24;1-7(2)4-3-5(6)8/h2-21H2,1H3,(H,23,24);3-4H2,1-2H3,(H2,6,8).
What are the key properties of 3-(dimethylamino)propanamide;docosanoic acid?
3-(dimethylamino)propanamide;docosanoic acid has a molecular weight of 456.76 g/mol, XLogP of 7.32, 23 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(dimethylamino)propanamide;docosanoic acid is sourced from PubChem (CID 87446955), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).