C8H17ClN2O — CID 141073365
5-(dimethylamino)-2-methylpent-2-enamide;hydrochloride (PubChem CID 141073365) has the molecular formula C8H17ClN2O and a molecular weight of 192.69 g/mol. Its IUPAC name is 5-(dimethylamino)-2-methylpent-2-enamide;hydrochloride.
| Compound Name | 5-(dimethylamino)-2-methylpent-2-enamide;hydrochloride |
|---|---|
| PubChem CID | 141073365 |
| Molecular Formula | C8H17ClN2O |
| Molecular Weight | 192.69 g/mol |
| Exact Mass | 192.10 |
| IUPAC Name | 5-(dimethylamino)-2-methylpent-2-enamide;hydrochloride |
| SMILES | CC(=CCCN(C)C)C(N)=O.Cl |
| InChI | InChI=1S/C8H16N2O.ClH/c1-7(8(9)11)5-4-6-10(2)3;/h5H,4,6H2,1-3H3,(H2,9,11);1H |
| InChIKey | ZRUVTNSMSQVYJQ-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.69 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|