About chloromethyl 5-(dimethylamino)-2-methylpent-2-enoate;hydrochloride
chloromethyl 5-(dimethylamino)-2-methylpent-2-enoate;hydrochloride (PubChem CID 175387120) has the molecular formula C9H17Cl2NO2
and a molecular weight of 242.15 g/mol. Its IUPAC name is chloromethyl 5-(dimethylamino)-2-methylpent-2-enoate;hydrochloride.
Molecular Properties
| Compound Name | chloromethyl 5-(dimethylamino)-2-methylpent-2-enoate;hydrochloride |
| PubChem CID | 175387120 |
| Molecular Formula | C9H17Cl2NO2 |
| Molecular Weight | 242.15 g/mol |
| Exact Mass | 241.06 |
| IUPAC Name | chloromethyl 5-(dimethylamino)-2-methylpent-2-enoate;hydrochloride |
| SMILES | CC(=CCCN(C)C)C(=O)OCCl.Cl |
| InChI | InChI=1S/C9H16ClNO2.ClH/c1-8(9(12)13-7-10)5-4-6-11(2)3;/h5H,4,6-7H2,1-3H3;1H |
| InChIKey | YMCRXKMZLQJUIC-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.15 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze chloromethyl 5-(dimethylamino)-2-methylpent-2-enoate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chloromethyl 5-(dimethylamino)-2-methylpent-2-enoate;hydrochloride?
The IUPAC name of chloromethyl 5-(dimethylamino)-2-methylpent-2-enoate;hydrochloride (CID 175387120) is chloromethyl 5-(dimethylamino)-2-methylpent-2-enoate;hydrochloride.
What is the SMILES notation for chloromethyl 5-(dimethylamino)-2-methylpent-2-enoate;hydrochloride?
The canonical SMILES for chloromethyl 5-(dimethylamino)-2-methylpent-2-enoate;hydrochloride is CC(=CCCN(C)C)C(=O)OCCl.Cl.
What is the InChIKey of chloromethyl 5-(dimethylamino)-2-methylpent-2-enoate;hydrochloride?
The InChIKey is YMCRXKMZLQJUIC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16ClNO2.ClH/c1-8(9(12)13-7-10)5-4-6-11(2)3;/h5H,4,6-7H2,1-3H3;1H.
What are the key properties of chloromethyl 5-(dimethylamino)-2-methylpent-2-enoate;hydrochloride?
chloromethyl 5-(dimethylamino)-2-methylpent-2-enoate;hydrochloride has a molecular weight of 242.15 g/mol, XLogP of 2.05, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for chloromethyl 5-(dimethylamino)-2-methylpent-2-enoate;hydrochloride is sourced from PubChem (CID 175387120), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).