About [chloro(phenyl)methyl] 5-(dimethylamino)-2-methylpent-2-enoate;tetrahydrate
[chloro(phenyl)methyl] 5-(dimethylamino)-2-methylpent-2-enoate;tetrahydrate (PubChem CID 175016372) has the molecular formula C15H28ClNO6
and a molecular weight of 353.84 g/mol. Its IUPAC name is [chloro(phenyl)methyl] 5-(dimethylamino)-2-methylpent-2-enoate;tetrahydrate.
Molecular Properties
| Compound Name | [chloro(phenyl)methyl] 5-(dimethylamino)-2-methylpent-2-enoate;tetrahydrate |
| PubChem CID | 175016372 |
| Molecular Formula | C15H28ClNO6 |
| Molecular Weight | 353.84 g/mol |
| Exact Mass | 353.16 |
| IUPAC Name | [chloro(phenyl)methyl] 5-(dimethylamino)-2-methylpent-2-enoate;tetrahydrate |
| SMILES | CC(=CCCN(C)C)C(=O)OC(Cl)c1ccccc1.O.O.O.O |
| InChI | InChI=1S/C15H20ClNO2.4H2O/c1-12(8-7-11-17(2)3)15(18)19-14(16)13-9-5-4-6-10-13;;;;/h4-6,8-10,14H,7,11H2,1-3H3;4*1H2 |
| InChIKey | DJVDFGZRGBKFIE-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 155.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.84 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze [chloro(phenyl)methyl] 5-(dimethylamino)-2-methylpent-2-enoate;tetrahydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [chloro(phenyl)methyl] 5-(dimethylamino)-2-methylpent-2-enoate;tetrahydrate?
The IUPAC name of [chloro(phenyl)methyl] 5-(dimethylamino)-2-methylpent-2-enoate;tetrahydrate (CID 175016372) is [chloro(phenyl)methyl] 5-(dimethylamino)-2-methylpent-2-enoate;tetrahydrate.
What is the SMILES notation for [chloro(phenyl)methyl] 5-(dimethylamino)-2-methylpent-2-enoate;tetrahydrate?
The canonical SMILES for [chloro(phenyl)methyl] 5-(dimethylamino)-2-methylpent-2-enoate;tetrahydrate is CC(=CCCN(C)C)C(=O)OC(Cl)c1ccccc1.O.O.O.O.
What is the InChIKey of [chloro(phenyl)methyl] 5-(dimethylamino)-2-methylpent-2-enoate;tetrahydrate?
The InChIKey is DJVDFGZRGBKFIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20ClNO2.4H2O/c1-12(8-7-11-17(2)3)15(18)19-14(16)13-9-5-4-6-10-13;;;;/h4-6,8-10,14H,7,11H2,1-3H3;4*1H2.
What are the key properties of [chloro(phenyl)methyl] 5-(dimethylamino)-2-methylpent-2-enoate;tetrahydrate?
[chloro(phenyl)methyl] 5-(dimethylamino)-2-methylpent-2-enoate;tetrahydrate has a molecular weight of 353.84 g/mol, XLogP of 0.07, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [chloro(phenyl)methyl] 5-(dimethylamino)-2-methylpent-2-enoate;tetrahydrate is sourced from PubChem (CID 175016372), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).