About 2-(dimethylamino)ethyl 2-chloro-2-phenylacetate
2-(dimethylamino)ethyl 2-chloro-2-phenylacetate (PubChem CID 101188921) has the molecular formula C12H16ClNO2
and a molecular weight of 241.72 g/mol. Its IUPAC name is 2-(dimethylamino)ethyl 2-chloro-2-phenylacetate.
Molecular Properties
| Compound Name | 2-(dimethylamino)ethyl 2-chloro-2-phenylacetate |
| PubChem CID | 101188921 |
| Molecular Formula | C12H16ClNO2 |
| Molecular Weight | 241.72 g/mol |
| Exact Mass | 241.09 |
| IUPAC Name | 2-(dimethylamino)ethyl 2-chloro-2-phenylacetate |
| SMILES | CN(C)CCOC(=O)C(Cl)c1ccccc1 |
| InChI | InChI=1S/C12H16ClNO2/c1-14(2)8-9-16-12(15)11(13)10-6-4-3-5-7-10/h3-7,11H,8-9H2,1-2H3 |
| InChIKey | LENGQFUJYXSTOH-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.72 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-(dimethylamino)ethyl 2-chloro-2-phenylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(dimethylamino)ethyl 2-chloro-2-phenylacetate?
The IUPAC name of 2-(dimethylamino)ethyl 2-chloro-2-phenylacetate (CID 101188921) is 2-(dimethylamino)ethyl 2-chloro-2-phenylacetate.
What is the SMILES notation for 2-(dimethylamino)ethyl 2-chloro-2-phenylacetate?
The canonical SMILES for 2-(dimethylamino)ethyl 2-chloro-2-phenylacetate is CN(C)CCOC(=O)C(Cl)c1ccccc1.
What is the InChIKey of 2-(dimethylamino)ethyl 2-chloro-2-phenylacetate?
The InChIKey is LENGQFUJYXSTOH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16ClNO2/c1-14(2)8-9-16-12(15)11(13)10-6-4-3-5-7-10/h3-7,11H,8-9H2,1-2H3.
What are the key properties of 2-(dimethylamino)ethyl 2-chloro-2-phenylacetate?
2-(dimethylamino)ethyl 2-chloro-2-phenylacetate has a molecular weight of 241.72 g/mol, XLogP of 2.07, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(dimethylamino)ethyl 2-chloro-2-phenylacetate is sourced from PubChem (CID 101188921), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).