C16H24ClNO3 — CID 82960088
2-chloro-N,N-bis(2-ethoxyethyl)-2-phenylacetamide (PubChem CID 82960088) has the molecular formula C16H24ClNO3 and a molecular weight of 313.83 g/mol. Its IUPAC name is 2-chloro-N,N-bis(2-ethoxyethyl)-2-phenylacetamide.
| Compound Name | 2-chloro-N,N-bis(2-ethoxyethyl)-2-phenylacetamide |
|---|---|
| PubChem CID | 82960088 |
| Molecular Formula | C16H24ClNO3 |
| Molecular Weight | 313.83 g/mol |
| Exact Mass | 313.14 |
| IUPAC Name | 2-chloro-N,N-bis(2-ethoxyethyl)-2-phenylacetamide |
| SMILES | CCOCCN(CCOCC)C(=O)C(Cl)c1ccccc1 |
| InChI | InChI=1S/C16H24ClNO3/c1-3-20-12-10-18(11-13-21-4-2)16(19)15(17)14-8-6-5-7-9-14/h5-9,15H,3-4,10-13H2,1-2H3 |
| InChIKey | NRCBRUGYEBJDAW-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.83 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|