C16H16ClNO — CID 43245479
2-chloro-N-ethyl-N,2-diphenylacetamide (PubChem CID 43245479) has the molecular formula C16H16ClNO and a molecular weight of 273.76 g/mol. Its IUPAC name is 2-chloro-N-ethyl-N,2-diphenylacetamide.
| Compound Name | 2-chloro-N-ethyl-N,2-diphenylacetamide |
|---|---|
| PubChem CID | 43245479 |
| Molecular Formula | C16H16ClNO |
| Molecular Weight | 273.76 g/mol |
| Exact Mass | 273.09 |
| IUPAC Name | 2-chloro-N-ethyl-N,2-diphenylacetamide |
| SMILES | CCN(C(=O)C(Cl)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C16H16ClNO/c1-2-18(14-11-7-4-8-12-14)16(19)15(17)13-9-5-3-6-10-13/h3-12,15H,2H2,1H3 |
| InChIKey | RMCRNRLSMSHDOO-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.76 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|