C17H15ClN2O — CID 43245519
2-chloro-N-(2-cyanoethyl)-N,2-diphenylacetamide (PubChem CID 43245519) has the molecular formula C17H15ClN2O and a molecular weight of 298.77 g/mol. Its IUPAC name is 2-chloro-N-(2-cyanoethyl)-N,2-diphenylacetamide.
| Compound Name | 2-chloro-N-(2-cyanoethyl)-N,2-diphenylacetamide |
|---|---|
| PubChem CID | 43245519 |
| Molecular Formula | C17H15ClN2O |
| Molecular Weight | 298.77 g/mol |
| Exact Mass | 298.09 |
| IUPAC Name | 2-chloro-N-(2-cyanoethyl)-N,2-diphenylacetamide |
| SMILES | N#CCCN(C(=O)C(Cl)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C17H15ClN2O/c18-16(14-8-3-1-4-9-14)17(21)20(13-7-12-19)15-10-5-2-6-11-15/h1-6,8-11,16H,7,13H2 |
| InChIKey | PTGXIJURDYHZTJ-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 44.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.77 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|