C18H16Cl2N2O2 — CID 4817772
N-(2-cyanoethyl)-2-(2,5-dichlorophenoxy)-N-phenylpropanamide (PubChem CID 4817772) has the molecular formula C18H16Cl2N2O2 and a molecular weight of 363.24 g/mol. Its IUPAC name is N-(2-cyanoethyl)-2-(2,5-dichlorophenoxy)-N-phenylpropanamide.
| Compound Name | N-(2-cyanoethyl)-2-(2,5-dichlorophenoxy)-N-phenylpropanamide |
|---|---|
| PubChem CID | 4817772 |
| Molecular Formula | C18H16Cl2N2O2 |
| Molecular Weight | 363.24 g/mol |
| Exact Mass | 362.06 |
| IUPAC Name | N-(2-cyanoethyl)-2-(2,5-dichlorophenoxy)-N-phenylpropanamide |
| SMILES | CC(Oc1cc(Cl)ccc1Cl)C(=O)N(CCC#N)c1ccccc1 |
| InChI | InChI=1S/C18H16Cl2N2O2/c1-13(24-17-12-14(19)8-9-16(17)20)18(23)22(11-5-10-21)15-6-3-2-4-7-15/h2-4,6-9,12-13H,5,11H2,1H3 |
| InChIKey | YBQFOBUAMSXJRD-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.24 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |