C13H15N3O4 — CID 61193258
2-[[2-cyanoethyl(phenyl)carbamoyl]amino]-3-hydroxypropanoic acid (PubChem CID 61193258) has the molecular formula C13H15N3O4 and a molecular weight of 277.28 g/mol. Its IUPAC name is 2-[[2-cyanoethyl(phenyl)carbamoyl]amino]-3-hydroxypropanoic acid.
| Compound Name | 2-[[2-cyanoethyl(phenyl)carbamoyl]amino]-3-hydroxypropanoic acid |
|---|---|
| PubChem CID | 61193258 |
| Molecular Formula | C13H15N3O4 |
| Molecular Weight | 277.28 g/mol |
| Exact Mass | 277.11 |
| IUPAC Name | 2-[[2-cyanoethyl(phenyl)carbamoyl]amino]-3-hydroxypropanoic acid |
| SMILES | N#CCCN(C(=O)NC(CO)C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C13H15N3O4/c14-7-4-8-16(10-5-2-1-3-6-10)13(20)15-11(9-17)12(18)19/h1-3,5-6,11,17H,4,8-9H2,(H,15,20)(H,18,19) |
| InChIKey | VVOSROHZNUMCRW-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 113.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.28 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |