C10H17N3O5 — CID 80756766
(2R)-2-[[2-cyanoethyl(2-methoxyethyl)carbamoyl]amino]-3-hydroxypropanoic acid (PubChem CID 80756766) has the molecular formula C10H17N3O5 and a molecular weight of 259.26 g/mol. Its IUPAC name is (2R)-2-[[2-cyanoethyl(2-methoxyethyl)carbamoyl]amino]-3-hydroxypropanoic acid.
| Compound Name | (2R)-2-[[2-cyanoethyl(2-methoxyethyl)carbamoyl]amino]-3-hydroxypropanoic acid |
|---|---|
| PubChem CID | 80756766 |
| Molecular Formula | C10H17N3O5 |
| Molecular Weight | 259.26 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | (2R)-2-[[2-cyanoethyl(2-methoxyethyl)carbamoyl]amino]-3-hydroxypropanoic acid |
| SMILES | COCCN(CCC#N)C(=O)N[C@H](CO)C(=O)O |
| InChI | InChI=1S/C10H17N3O5/c1-18-6-5-13(4-2-3-11)10(17)12-8(7-14)9(15)16/h8,14H,2,4-7H2,1H3,(H,12,17)(H,15,16)/t8-/m1/s1 |
| InChIKey | NGZLCRKMKCWSEA-MRVPVSSYSA-N |
| XLogP | -1.00 |
| TPSA | 122.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.26 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |