C10H18N2O7 — CID 113467934
(2R)-2-[[2-hydroxyethyl(2-methoxyethyl)carbamoyl]amino]butanedioic acid (PubChem CID 113467934) has the molecular formula C10H18N2O7 and a molecular weight of 278.26 g/mol. Its IUPAC name is (2R)-2-[[2-hydroxyethyl(2-methoxyethyl)carbamoyl]amino]butanedioic acid.
| Compound Name | (2R)-2-[[2-hydroxyethyl(2-methoxyethyl)carbamoyl]amino]butanedioic acid |
|---|---|
| PubChem CID | 113467934 |
| Molecular Formula | C10H18N2O7 |
| Molecular Weight | 278.26 g/mol |
| Exact Mass | 278.11 |
| IUPAC Name | (2R)-2-[[2-hydroxyethyl(2-methoxyethyl)carbamoyl]amino]butanedioic acid |
| SMILES | COCCN(CCO)C(=O)N[C@H](CC(=O)O)C(=O)O |
| InChI | InChI=1S/C10H18N2O7/c1-19-5-3-12(2-4-13)10(18)11-7(9(16)17)6-8(14)15/h7,13H,2-6H2,1H3,(H,11,18)(H,14,15)(H,16,17)/t7-/m1/s1 |
| InChIKey | MTQWUZITPDZGGI-SSDOTTSWSA-N |
| XLogP | -1.44 |
| TPSA | 136.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.26 |
| LogP ≤ 5 | -1.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |