C10H20N2O6 — CID 80755955
(2R)-2-[bis(2-methoxyethyl)carbamoylamino]-3-hydroxypropanoic acid (PubChem CID 80755955) has the molecular formula C10H20N2O6 and a molecular weight of 264.28 g/mol. Its IUPAC name is (2R)-2-[bis(2-methoxyethyl)carbamoylamino]-3-hydroxypropanoic acid.
| Compound Name | (2R)-2-[bis(2-methoxyethyl)carbamoylamino]-3-hydroxypropanoic acid |
|---|---|
| PubChem CID | 80755955 |
| Molecular Formula | C10H20N2O6 |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.13 |
| IUPAC Name | (2R)-2-[bis(2-methoxyethyl)carbamoylamino]-3-hydroxypropanoic acid |
| SMILES | COCCN(CCOC)C(=O)N[C@H](CO)C(=O)O |
| InChI | InChI=1S/C10H20N2O6/c1-17-5-3-12(4-6-18-2)10(16)11-8(7-13)9(14)15/h8,13H,3-7H2,1-2H3,(H,11,16)(H,14,15)/t8-/m1/s1 |
| InChIKey | IJDMYQTVXWJNKJ-MRVPVSSYSA-N |
| XLogP | -1.26 |
| TPSA | 108.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | -1.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |