C12H21N3O4 — CID 63286518
(2S)-2-[[2-cyanoethyl(2-methoxyethyl)carbamoyl]amino]-3-methylbutanoic acid (PubChem CID 63286518) has the molecular formula C12H21N3O4 and a molecular weight of 271.32 g/mol. Its IUPAC name is (2S)-2-[[2-cyanoethyl(2-methoxyethyl)carbamoyl]amino]-3-methylbutanoic acid.
| Compound Name | (2S)-2-[[2-cyanoethyl(2-methoxyethyl)carbamoyl]amino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 63286518 |
| Molecular Formula | C12H21N3O4 |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.15 |
| IUPAC Name | (2S)-2-[[2-cyanoethyl(2-methoxyethyl)carbamoyl]amino]-3-methylbutanoic acid |
| SMILES | COCCN(CCC#N)C(=O)N[C@H](C(=O)O)C(C)C |
| InChI | InChI=1S/C12H21N3O4/c1-9(2)10(11(16)17)14-12(18)15(6-4-5-13)7-8-19-3/h9-10H,4,6-8H2,1-3H3,(H,14,18)(H,16,17)/t10-/m0/s1 |
| InChIKey | FXQVVUZKUYJVHB-JTQLQIEISA-N |
| XLogP | 0.67 |
| TPSA | 102.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |