C10H20N2O5 — CID 61235989
(2S)-2-[bis(2-hydroxyethyl)carbamoylamino]-3-methylbutanoic acid (PubChem CID 61235989) has the molecular formula C10H20N2O5 and a molecular weight of 248.28 g/mol. Its IUPAC name is (2S)-2-[bis(2-hydroxyethyl)carbamoylamino]-3-methylbutanoic acid.
| Compound Name | (2S)-2-[bis(2-hydroxyethyl)carbamoylamino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 61235989 |
| Molecular Formula | C10H20N2O5 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.14 |
| IUPAC Name | (2S)-2-[bis(2-hydroxyethyl)carbamoylamino]-3-methylbutanoic acid |
| SMILES | CC(C)[C@H](NC(=O)N(CCO)CCO)C(=O)O |
| InChI | InChI=1S/C10H20N2O5/c1-7(2)8(9(15)16)11-10(17)12(3-5-13)4-6-14/h7-8,13-14H,3-6H2,1-2H3,(H,11,17)(H,15,16)/t8-/m0/s1 |
| InChIKey | LJUDOKREAPTWGV-QMMMGPOBSA-N |
| XLogP | -0.91 |
| TPSA | 110.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | -0.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |