C11H22N2O4 — CID 82041809
2-[3-[2-hydroxyethyl(methyl)amino]propanoylamino]-3-methylbutanoic acid (PubChem CID 82041809) has the molecular formula C11H22N2O4 and a molecular weight of 246.31 g/mol. Its IUPAC name is 2-[3-[2-hydroxyethyl(methyl)amino]propanoylamino]-3-methylbutanoic acid.
| Compound Name | 2-[3-[2-hydroxyethyl(methyl)amino]propanoylamino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 82041809 |
| Molecular Formula | C11H22N2O4 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.16 |
| IUPAC Name | 2-[3-[2-hydroxyethyl(methyl)amino]propanoylamino]-3-methylbutanoic acid |
| SMILES | CC(C)C(NC(=O)CCN(C)CCO)C(=O)O |
| InChI | InChI=1S/C11H22N2O4/c1-8(2)10(11(16)17)12-9(15)4-5-13(3)6-7-14/h8,10,14H,4-7H2,1-3H3,(H,12,15)(H,16,17) |
| InChIKey | HXVVQVAXFDHQMG-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |