C11H22N2O6 — CID 61418747
2-[bis(2-methoxyethyl)carbamoylamino]-3-hydroxybutanoic acid (PubChem CID 61418747) has the molecular formula C11H22N2O6 and a molecular weight of 278.31 g/mol. Its IUPAC name is 2-[bis(2-methoxyethyl)carbamoylamino]-3-hydroxybutanoic acid.
| Compound Name | 2-[bis(2-methoxyethyl)carbamoylamino]-3-hydroxybutanoic acid |
|---|---|
| PubChem CID | 61418747 |
| Molecular Formula | C11H22N2O6 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | 2-[bis(2-methoxyethyl)carbamoylamino]-3-hydroxybutanoic acid |
| SMILES | COCCN(CCOC)C(=O)NC(C(=O)O)C(C)O |
| InChI | InChI=1S/C11H22N2O6/c1-8(14)9(10(15)16)12-11(17)13(4-6-18-2)5-7-19-3/h8-9,14H,4-7H2,1-3H3,(H,12,17)(H,15,16) |
| InChIKey | VSALHCUAGCLCOO-UHFFFAOYSA-N |
| XLogP | -0.88 |
| TPSA | 108.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |