C20H23N3O — CID 78820379
N-(2-cyanoethyl)-2-(3,5-dimethylanilino)-N-phenylpropanamide (PubChem CID 78820379) has the molecular formula C20H23N3O and a molecular weight of 321.42 g/mol. Its IUPAC name is N-(2-cyanoethyl)-2-(3,5-dimethylanilino)-N-phenylpropanamide.
| Compound Name | N-(2-cyanoethyl)-2-(3,5-dimethylanilino)-N-phenylpropanamide |
|---|---|
| PubChem CID | 78820379 |
| Molecular Formula | C20H23N3O |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.18 |
| IUPAC Name | N-(2-cyanoethyl)-2-(3,5-dimethylanilino)-N-phenylpropanamide |
| SMILES | Cc1cc(C)cc(NC(C)C(=O)N(CCC#N)c2ccccc2)c1 |
| InChI | InChI=1S/C20H23N3O/c1-15-12-16(2)14-18(13-15)22-17(3)20(24)23(11-7-10-21)19-8-5-4-6-9-19/h4-6,8-9,12-14,17,22H,7,11H2,1-3H3 |
| InChIKey | WJBUNQCOWDNHIP-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |