C19H21N3O2 — CID 110880289
N-(2-cyanoethyl)-2-[3-(hydroxymethyl)anilino]-N-phenylpropanamide (PubChem CID 110880289) has the molecular formula C19H21N3O2 and a molecular weight of 323.40 g/mol. Its IUPAC name is N-(2-cyanoethyl)-2-[3-(hydroxymethyl)anilino]-N-phenylpropanamide.
| Compound Name | N-(2-cyanoethyl)-2-[3-(hydroxymethyl)anilino]-N-phenylpropanamide |
|---|---|
| PubChem CID | 110880289 |
| Molecular Formula | C19H21N3O2 |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.16 |
| IUPAC Name | N-(2-cyanoethyl)-2-[3-(hydroxymethyl)anilino]-N-phenylpropanamide |
| SMILES | CC(Nc1cccc(CO)c1)C(=O)N(CCC#N)c1ccccc1 |
| InChI | InChI=1S/C19H21N3O2/c1-15(21-17-8-5-7-16(13-17)14-23)19(24)22(12-6-11-20)18-9-3-2-4-10-18/h2-5,7-10,13,15,21,23H,6,12,14H2,1H3 |
| InChIKey | UDVMOAWWYYYKEF-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 76.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |