C16H22N2O — CID 97329844
(2R)-N-(2-cyanoethyl)-N-ethyl-3-methyl-2-phenylbutanamide (PubChem CID 97329844) has the molecular formula C16H22N2O and a molecular weight of 258.37 g/mol. Its IUPAC name is (2R)-N-(2-cyanoethyl)-N-ethyl-3-methyl-2-phenylbutanamide.
| Compound Name | (2R)-N-(2-cyanoethyl)-N-ethyl-3-methyl-2-phenylbutanamide |
|---|---|
| PubChem CID | 97329844 |
| Molecular Formula | C16H22N2O |
| Molecular Weight | 258.37 g/mol |
| Exact Mass | 258.17 |
| IUPAC Name | (2R)-N-(2-cyanoethyl)-N-ethyl-3-methyl-2-phenylbutanamide |
| SMILES | CCN(CCC#N)C(=O)[C@@H](c1ccccc1)C(C)C |
| InChI | InChI=1S/C16H22N2O/c1-4-18(12-8-11-17)16(19)15(13(2)3)14-9-6-5-7-10-14/h5-7,9-10,13,15H,4,8,12H2,1-3H3/t15-/m1/s1 |
| InChIKey | MAMIMNTUYZZKSC-OAHLLOKOSA-N |
| XLogP | 3.19 |
| TPSA | 44.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.37 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |