C16H23N3O — CID 78822383
2-[2-cyanoethyl(methyl)amino]-N,N-diethyl-2-phenylacetamide (PubChem CID 78822383) has the molecular formula C16H23N3O and a molecular weight of 273.38 g/mol. Its IUPAC name is 2-[2-cyanoethyl(methyl)amino]-N,N-diethyl-2-phenylacetamide.
| Compound Name | 2-[2-cyanoethyl(methyl)amino]-N,N-diethyl-2-phenylacetamide |
|---|---|
| PubChem CID | 78822383 |
| Molecular Formula | C16H23N3O |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.18 |
| IUPAC Name | 2-[2-cyanoethyl(methyl)amino]-N,N-diethyl-2-phenylacetamide |
| SMILES | CCN(CC)C(=O)C(c1ccccc1)N(C)CCC#N |
| InChI | InChI=1S/C16H23N3O/c1-4-19(5-2)16(20)15(18(3)13-9-12-17)14-10-7-6-8-11-14/h6-8,10-11,15H,4-5,9,13H2,1-3H3 |
| InChIKey | DVNHAKFSOSKZNR-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 47.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |