C12H17NO2 — CID 90474492
2-deuterio-N,N-diethyl-2-hydroxy-2-phenylacetamide (PubChem CID 90474492) has the molecular formula C12H17NO2 and a molecular weight of 208.28 g/mol. Its IUPAC name is 2-deuterio-N,N-diethyl-2-hydroxy-2-phenylacetamide.
| Compound Name | 2-deuterio-N,N-diethyl-2-hydroxy-2-phenylacetamide |
|---|---|
| PubChem CID | 90474492 |
| Molecular Formula | C12H17NO2 |
| Molecular Weight | 208.28 g/mol |
| Exact Mass | 208.13 |
| IUPAC Name | 2-deuterio-N,N-diethyl-2-hydroxy-2-phenylacetamide |
| SMILES | [2H]C(O)(C(=O)N(CC)CC)c1ccccc1 |
| InChI | InChI=1S/C12H17NO2/c1-3-13(4-2)12(15)11(14)10-8-6-5-7-9-10/h5-9,11,14H,3-4H2,1-2H3/i11D |
| InChIKey | UXLCWYBQDGCVQE-WORMITQPSA-N |
| XLogP | 1.59 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.28 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |