C14H21NO3 — CID 101353525
[(1R,2S)-1-hydroxy-1-phenylpropan-2-yl] N,N-diethylcarbamate (PubChem CID 101353525) has the molecular formula C14H21NO3 and a molecular weight of 251.33 g/mol. Its IUPAC name is [(1R,2S)-1-hydroxy-1-phenylpropan-2-yl] N,N-diethylcarbamate.
| Compound Name | [(1R,2S)-1-hydroxy-1-phenylpropan-2-yl] N,N-diethylcarbamate |
|---|---|
| PubChem CID | 101353525 |
| Molecular Formula | C14H21NO3 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.15 |
| IUPAC Name | [(1R,2S)-1-hydroxy-1-phenylpropan-2-yl] N,N-diethylcarbamate |
| SMILES | CCN(CC)C(=O)O[C@@H](C)[C@H](O)c1ccccc1 |
| InChI | InChI=1S/C14H21NO3/c1-4-15(5-2)14(17)18-11(3)13(16)12-9-7-6-8-10-12/h6-11,13,16H,4-5H2,1-3H3/t11-,13-/m0/s1 |
| InChIKey | BWEHZLVXMQINKF-AAEUAGOBSA-N |
| XLogP | 2.59 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |