C11H16NO3+ — CID 7321538
[(2S,3S)-1-ethoxy-3-hydroxy-1-oxo-3-phenylpropan-2-yl]azanium (PubChem CID 7321538) has the molecular formula C11H16NO3+ and a molecular weight of 210.25 g/mol. Its IUPAC name is [(2S,3S)-1-ethoxy-3-hydroxy-1-oxo-3-phenylpropan-2-yl]azanium.
| Compound Name | [(2S,3S)-1-ethoxy-3-hydroxy-1-oxo-3-phenylpropan-2-yl]azanium |
|---|---|
| PubChem CID | 7321538 |
| Molecular Formula | C11H16NO3+ |
| Molecular Weight | 210.25 g/mol |
| Exact Mass | 210.11 |
| IUPAC Name | [(2S,3S)-1-ethoxy-3-hydroxy-1-oxo-3-phenylpropan-2-yl]azanium |
| SMILES | CCOC(=O)[C@@H]([NH3+])[C@@H](O)c1ccccc1 |
| InChI | InChI=1S/C11H15NO3/c1-2-15-11(14)9(12)10(13)8-6-4-3-5-7-8/h3-7,9-10,13H,2,12H2,1H3/p+1/t9-,10-/m0/s1 |
| InChIKey | RCUYHYDTFXMONZ-UWVGGRQHSA-O |
| XLogP | -0.11 |
| TPSA | 74.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.25 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |