C11H16ClNO3 — CID 166438818
ethyl (2S,3S)-2-amino-3-hydroxy-3-phenylpropanoate;hydrochloride (PubChem CID 166438818) has the molecular formula C11H16ClNO3 and a molecular weight of 245.71 g/mol. Its IUPAC name is ethyl (2S,3S)-2-amino-3-hydroxy-3-phenylpropanoate;hydrochloride.
| Compound Name | ethyl (2S,3S)-2-amino-3-hydroxy-3-phenylpropanoate;hydrochloride |
|---|---|
| PubChem CID | 166438818 |
| Molecular Formula | C11H16ClNO3 |
| Molecular Weight | 245.71 g/mol |
| Exact Mass | 245.08 |
| IUPAC Name | ethyl (2S,3S)-2-amino-3-hydroxy-3-phenylpropanoate;hydrochloride |
| SMILES | CCOC(=O)[C@@H](N)[C@@H](O)c1ccccc1.Cl |
| InChI | InChI=1S/C11H15NO3.ClH/c1-2-15-11(14)9(12)10(13)8-6-4-3-5-7-8;/h3-7,9-10,13H,2,12H2,1H3;1H/t9-,10-;/m0./s1 |
| InChIKey | PKHKERPKLCPPGI-IYPAPVHQSA-N |
| XLogP | 1.03 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.71 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |