About ethyl 2-hydroxy-2-phenylacetate;methane;dihydrochloride
ethyl 2-hydroxy-2-phenylacetate;methane;dihydrochloride (PubChem CID 174768847) has the molecular formula C11H18Cl2O3
and a molecular weight of 269.17 g/mol. Its IUPAC name is ethyl 2-hydroxy-2-phenylacetate;methane;dihydrochloride.
Molecular Properties
| Compound Name | ethyl 2-hydroxy-2-phenylacetate;methane;dihydrochloride |
| PubChem CID | 174768847 |
| Molecular Formula | C11H18Cl2O3 |
| Molecular Weight | 269.17 g/mol |
| Exact Mass | 268.06 |
| IUPAC Name | ethyl 2-hydroxy-2-phenylacetate;methane;dihydrochloride |
| SMILES | C.CCOC(=O)C(O)c1ccccc1.Cl.Cl |
| InChI | InChI=1S/C10H12O3.CH4.2ClH/c1-2-13-10(12)9(11)8-6-4-3-5-7-8;;;/h3-7,9,11H,2H2,1H3;1H4;2*1H |
| InChIKey | RJCYRMBYNGYRGZ-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.17 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethyl 2-hydroxy-2-phenylacetate;methane;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-hydroxy-2-phenylacetate;methane;dihydrochloride?
The IUPAC name of ethyl 2-hydroxy-2-phenylacetate;methane;dihydrochloride (CID 174768847) is ethyl 2-hydroxy-2-phenylacetate;methane;dihydrochloride.
What is the SMILES notation for ethyl 2-hydroxy-2-phenylacetate;methane;dihydrochloride?
The canonical SMILES for ethyl 2-hydroxy-2-phenylacetate;methane;dihydrochloride is C.CCOC(=O)C(O)c1ccccc1.Cl.Cl.
What is the InChIKey of ethyl 2-hydroxy-2-phenylacetate;methane;dihydrochloride?
The InChIKey is RJCYRMBYNGYRGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12O3.CH4.2ClH/c1-2-13-10(12)9(11)8-6-4-3-5-7-8;;;/h3-7,9,11H,2H2,1H3;1H4;2*1H.
What are the key properties of ethyl 2-hydroxy-2-phenylacetate;methane;dihydrochloride?
ethyl 2-hydroxy-2-phenylacetate;methane;dihydrochloride has a molecular weight of 269.17 g/mol, XLogP of 2.76, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-hydroxy-2-phenylacetate;methane;dihydrochloride is sourced from PubChem (CID 174768847), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).